About (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one
(E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 59463399) has the molecular formula C20H18N2O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one |
| PubChem CID | 59463399 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)/C=C/c2ccccc2O)cn1 |
| InChI | InChI=1S/C20H18N2O2/c1-14-7-8-15(2)22(14)20-12-10-17(13-21-20)19(24)11-9-16-5-3-4-6-18(16)23/h3-13,23H,1-2H3/b11-9+ |
| InChIKey | FRALJQYQTLLXFQ-PKNBQFBNSA-N |
| XLogP | 4.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one?
The IUPAC name of (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one (CID 59463399) is (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one is Cc1ccc(C)n1-c1ccc(C(=O)/C=C/c2ccccc2O)cn1.
What is the InChIKey of (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one?
The InChIKey is FRALJQYQTLLXFQ-PKNBQFBNSA-N. The full InChI is InChI=1S/C20H18N2O2/c1-14-7-8-15(2)22(14)20-12-10-17(13-21-20)19(24)11-9-16-5-3-4-6-18(16)23/h3-13,23H,1-2H3/b11-9+.
What are the key properties of (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one?
(E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one has a molecular weight of 318.38 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-3-(2-hydroxyphenyl)prop-2-en-1-one is sourced from PubChem (CID 59463399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).