C12H19FN2OS — CID 59463861
2-(2-tert-butyl-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)ethanol (PubChem CID 59463861) has the molecular formula C12H19FN2OS and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)ethanol.
| Compound Name | 2-(2-tert-butyl-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)ethanol |
|---|---|
| PubChem CID | 59463861 |
| Molecular Formula | C12H19FN2OS |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(2-tert-butyl-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)ethanol |
| SMILES | CC(C)(C)c1nc2c(s1)CCN(CCO)C2F |
| InChI | InChI=1S/C12H19FN2OS/c1-12(2,3)11-14-9-8(17-11)4-5-15(6-7-16)10(9)13/h10,16H,4-7H2,1-3H3 |
| InChIKey | XZYYJSDFKPALNQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|