C11H17FN2S — CID 59463927
2-tert-butyl-4-fluoro-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 59463927) has the molecular formula C11H17FN2S and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-tert-butyl-4-fluoro-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-tert-butyl-4-fluoro-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 59463927 |
| Molecular Formula | C11H17FN2S |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-tert-butyl-4-fluoro-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CN1CCc2sc(C(C)(C)C)nc2C1F |
| InChI | InChI=1S/C11H17FN2S/c1-11(2,3)10-13-8-7(15-10)5-6-14(4)9(8)12/h9H,5-6H2,1-4H3 |
| InChIKey | VFFNDALFDWXLFU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|