About 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one
2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one (PubChem CID 59463978) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one |
| PubChem CID | 59463978 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one |
| SMILES | CC1(C)CC(=O)N=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C10H17NO2/c1-9(2,3)8-11-7(12)6-10(4,5)13-8/h6H2,1-5H3 |
| InChIKey | DDLLXNATFCDBSQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one?
The IUPAC name of 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one (CID 59463978) is 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one.
What is the SMILES notation for 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one?
The canonical SMILES for 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one is CC1(C)CC(=O)N=C(C(C)(C)C)O1.
What is the InChIKey of 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one?
The InChIKey is DDLLXNATFCDBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-9(2,3)8-11-7(12)6-10(4,5)13-8/h6H2,1-5H3.
What are the key properties of 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one?
2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one has a molecular weight of 183.25 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6,6-dimethyl-5H-1,3-oxazin-4-one is sourced from PubChem (CID 59463978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).