C13H20FN3O2S — CID 59464018
2-tert-butyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide (PubChem CID 59464018) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-tert-butyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide.
| Compound Name | 2-tert-butyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 59464018 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-tert-butyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide |
| SMILES | CON(C)C(=O)N1CCc2sc(C(C)(C)C)nc2C1F |
| InChI | InChI=1S/C13H20FN3O2S/c1-13(2,3)11-15-9-8(20-11)6-7-17(10(9)14)12(18)16(4)19-5/h10H,6-7H2,1-5H3 |
| InChIKey | MAFDIEJGUQHLRA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|