About [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate
[2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate (PubChem CID 59464454) has the molecular formula C26H32O6
and a molecular weight of 440.54 g/mol. Its IUPAC name is [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate.
Molecular Properties
| Compound Name | [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate |
| PubChem CID | 59464454 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate |
| SMILES | CC(COC(=O)COc1ccc(C(=O)C(C)C)cc1)COC(=O)CC(C)c1ccccc1 |
| InChI | InChI=1S/C26H32O6/c1-18(2)26(29)22-10-12-23(13-11-22)30-17-25(28)32-16-19(3)15-31-24(27)14-20(4)21-8-6-5-7-9-21/h5-13,18-20H,14-17H2,1-4H3 |
| InChIKey | XEIVKFNPRORNNV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate?
The IUPAC name of [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate (CID 59464454) is [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate.
What is the SMILES notation for [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate?
The canonical SMILES for [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate is CC(COC(=O)COc1ccc(C(=O)C(C)C)cc1)COC(=O)CC(C)c1ccccc1.
What is the InChIKey of [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate?
The InChIKey is XEIVKFNPRORNNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O6/c1-18(2)26(29)22-10-12-23(13-11-22)30-17-25(28)32-16-19(3)15-31-24(27)14-20(4)21-8-6-5-7-9-21/h5-13,18-20H,14-17H2,1-4H3.
What are the key properties of [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate?
[2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate has a molecular weight of 440.54 g/mol, XLogP of 4.82, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-3-[2-[4-(2-methylpropanoyl)phenoxy]acetyl]oxypropyl] 3-phenylbutanoate is sourced from PubChem (CID 59464454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).