About [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate
[3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate (PubChem CID 59464519) has the molecular formula C23H30O4
and a molecular weight of 370.49 g/mol. Its IUPAC name is [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate.
Molecular Properties
| Compound Name | [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate |
| PubChem CID | 59464519 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate |
| SMILES | COC(C)c1ccc(COCC(C)COC(=O)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-17(15-27-23(24)18(2)21-8-6-5-7-9-21)14-26-16-20-10-12-22(13-11-20)19(3)25-4/h5-13,17-19H,14-16H2,1-4H3 |
| InChIKey | SKYCDGUCDCMXRY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate?
The IUPAC name of [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate (CID 59464519) is [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate.
What is the SMILES notation for [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate?
The canonical SMILES for [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate is COC(C)c1ccc(COCC(C)COC(=O)C(C)c2ccccc2)cc1.
What is the InChIKey of [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate?
The InChIKey is SKYCDGUCDCMXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O4/c1-17(15-27-23(24)18(2)21-8-6-5-7-9-21)14-26-16-20-10-12-22(13-11-20)19(3)25-4/h5-13,17-19H,14-16H2,1-4H3.
What are the key properties of [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate?
[3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate has a molecular weight of 370.49 g/mol, XLogP of 4.89, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-(1-methoxyethyl)phenyl]methoxy]-2-methylpropyl] 2-phenylpropanoate is sourced from PubChem (CID 59464519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).