About 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane
2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane (PubChem CID 59465024) has the molecular formula C5H2F6O2
and a molecular weight of 208.06 g/mol. Its IUPAC name is 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane |
| PubChem CID | 59465024 |
| Molecular Formula | C5H2F6O2 |
| Molecular Weight | 208.06 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane |
| SMILES | FCC1(F)OC(=C(F)F)OC1(F)F |
| InChI | InChI=1S/C5H2F6O2/c6-1-4(9)5(10,11)13-3(12-4)2(7)8/h1H2 |
| InChIKey | ANFSYRMIXVLYCZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.06 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane?
The IUPAC name of 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane (CID 59465024) is 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane.
What is the SMILES notation for 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane?
The canonical SMILES for 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane is FCC1(F)OC(=C(F)F)OC1(F)F.
What is the InChIKey of 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane?
The InChIKey is ANFSYRMIXVLYCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F6O2/c6-1-4(9)5(10,11)13-3(12-4)2(7)8/h1H2.
What are the key properties of 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane?
2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane has a molecular weight of 208.06 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethylidene)-4,4,5-trifluoro-5-(fluoromethyl)-1,3-dioxolane is sourced from PubChem (CID 59465024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).