C18H18FN3O2 — CID 59465339
(9R,10R)-10-[(2S)-3-azido-2-hydroxypropyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-ol (PubChem CID 59465339) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is (9R,10R)-10-[(2S)-3-azido-2-hydroxypropyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-ol.
| Compound Name | (9R,10R)-10-[(2S)-3-azido-2-hydroxypropyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-ol |
|---|---|
| PubChem CID | 59465339 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (9R,10R)-10-[(2S)-3-azido-2-hydroxypropyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-ol |
| SMILES | [N-]=[N+]=NC[C@@H](O)C[C@@H]1c2ccccc2Cc2ccc(F)cc2[C@@H]1O |
| InChI | InChI=1S/C18H18FN3O2/c19-13-6-5-12-7-11-3-1-2-4-15(11)17(18(24)16(12)8-13)9-14(23)10-21-22-20/h1-6,8,14,17-18,23-24H,7,9-10H2/t14-,17+,18-/m0/s1 |
| InChIKey | HKOOEPLLBIUISG-QGTPRVQTSA-N |
| XLogP | 3.61 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|