C24H27FO3 — CID 59465371
(10R)-10-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one (PubChem CID 59465371) has the molecular formula C24H27FO3 and a molecular weight of 382.48 g/mol. Its IUPAC name is (10R)-10-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one.
| Compound Name | (10R)-10-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
|---|---|
| PubChem CID | 59465371 |
| Molecular Formula | C24H27FO3 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (10R)-10-[2-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
| SMILES | CCC1(CC)OC[C@H](CC[C@H]2C(=O)c3cc(F)ccc3Cc3ccccc32)O1 |
| InChI | InChI=1S/C24H27FO3/c1-3-24(4-2)27-15-19(28-24)11-12-21-20-8-6-5-7-16(20)13-17-9-10-18(25)14-22(17)23(21)26/h5-10,14,19,21H,3-4,11-13,15H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | FNWJRFMCUYHSTI-PZJWPPBQSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |