About 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea
1-(3,3-dimethylbutyl)-1,3,3-trimethylurea (PubChem CID 59465499) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea |
| PubChem CID | 59465499 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)CCC(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-10(2,3)7-8-12(6)9(13)11(4)5/h7-8H2,1-6H3 |
| InChIKey | LMBXDNJXIJBNIJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea?
The IUPAC name of 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea (CID 59465499) is 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea.
What is the SMILES notation for 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea?
The canonical SMILES for 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea is CN(C)C(=O)N(C)CCC(C)(C)C.
What is the InChIKey of 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea?
The InChIKey is LMBXDNJXIJBNIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-10(2,3)7-8-12(6)9(13)11(4)5/h7-8H2,1-6H3.
What are the key properties of 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea?
1-(3,3-dimethylbutyl)-1,3,3-trimethylurea has a molecular weight of 186.30 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutyl)-1,3,3-trimethylurea is sourced from PubChem (CID 59465499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).