About 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one
5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 59465568) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one |
| PubChem CID | 59465568 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | Nc1cccc(-c2n[nH]c(=O)o2)c1 |
| InChI | InChI=1S/C8H7N3O2/c9-6-3-1-2-5(4-6)7-10-11-8(12)13-7/h1-4H,9H2,(H,11,12) |
| InChIKey | FMEJFHGVOSDBJC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one?
The IUPAC name of 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one (CID 59465568) is 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one?
The canonical SMILES for 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one is Nc1cccc(-c2n[nH]c(=O)o2)c1.
What is the InChIKey of 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one?
The InChIKey is FMEJFHGVOSDBJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-6-3-1-2-5(4-6)7-10-11-8(12)13-7/h1-4H,9H2,(H,11,12).
What are the key properties of 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one?
5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one has a molecular weight of 177.16 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminophenyl)-3H-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 59465568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).