About 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid
5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 59465581) has the molecular formula C25H32O4S
and a molecular weight of 428.59 g/mol. Its IUPAC name is 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid |
| PubChem CID | 59465581 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCC(O)c1ccc([C@H]2CCC(=O)[C@@H]2CCCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C25H32O4S/c1-2-3-4-8-22(26)18-11-9-17(10-12-18)20-14-15-23(27)21(20)7-5-6-19-13-16-24(30-19)25(28)29/h9-13,16,20-22,26H,2-8,14-15H2,1H3,(H,28,29)/t20-,21-,22?/m1/s1 |
| InChIKey | BKEIZHJYCQKMOM-JAZPPYFYSA-N |
| XLogP | 6.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid (CID 59465581) is 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid is CCCCCC(O)c1ccc([C@H]2CCC(=O)[C@@H]2CCCc2ccc(C(=O)O)s2)cc1.
What is the InChIKey of 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid?
The InChIKey is BKEIZHJYCQKMOM-JAZPPYFYSA-N. The full InChI is InChI=1S/C25H32O4S/c1-2-3-4-8-22(26)18-11-9-17(10-12-18)20-14-15-23(27)21(20)7-5-6-19-13-16-24(30-19)25(28)29/h9-13,16,20-22,26H,2-8,14-15H2,1H3,(H,28,29)/t20-,21-,22?/m1/s1.
What are the key properties of 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid?
5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid has a molecular weight of 428.59 g/mol, XLogP of 6.15, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(1R,2S)-2-[4-(1-hydroxyhexyl)phenyl]-5-oxocyclopentyl]propyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 59465581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).