C25H31FN6O3S2 — CID 59466225
(1Z)-1-(1-aminoethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea (PubChem CID 59466225) has the molecular formula C25H31FN6O3S2 and a molecular weight of 546.69 g/mol. Its IUPAC name is (1Z)-1-(1-aminoethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea.
| Compound Name | (1Z)-1-(1-aminoethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea |
|---|---|
| PubChem CID | 59466225 |
| Molecular Formula | C25H31FN6O3S2 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | (1Z)-1-(1-aminoethylidene)-3-[4-[4-[(2R)-2-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)propanoyl]piperazin-1-yl]phenyl]sulfonylthiourea |
| SMILES | C/C(N)=N/C(=S)NS(=O)(=O)c1ccc(N2CCN(C(=O)[C@@H](C)N3CCCc4cc(F)ccc43)CC2)cc1 |
| InChI | InChI=1S/C25H31FN6O3S2/c1-17(32-11-3-4-19-16-20(26)5-10-23(19)32)24(33)31-14-12-30(13-15-31)21-6-8-22(9-7-21)37(34,35)29-25(36)28-18(2)27/h5-10,16-17H,3-4,11-15H2,1-2H3,(H3,27,28,29,36)/t17-/m1/s1 |
| InChIKey | OLLMVHBEYDGQOC-QGZVFWFLSA-N |
| XLogP | 2.26 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|