C22H26O7 — CID 59466633
(10E,13S,14S,16Z)-5,13,14-trihydroxy-7-methoxy-2-oxatricyclo[16.4.0.04,9]docosa-4(9),5,7,10,16-pentaene-3,15-dione (PubChem CID 59466633) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is (10E,13S,14S,16Z)-5,13,14-trihydroxy-7-methoxy-2-oxatricyclo[16.4.0.04,9]docosa-4(9),5,7,10,16-pentaene-3,15-dione.
| Compound Name | (10E,13S,14S,16Z)-5,13,14-trihydroxy-7-methoxy-2-oxatricyclo[16.4.0.04,9]docosa-4(9),5,7,10,16-pentaene-3,15-dione |
|---|---|
| PubChem CID | 59466633 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (10E,13S,14S,16Z)-5,13,14-trihydroxy-7-methoxy-2-oxatricyclo[16.4.0.04,9]docosa-4(9),5,7,10,16-pentaene-3,15-dione |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\C1CCCCC1OC2=O |
| InChI | InChI=1S/C22H26O7/c1-28-15-11-14-6-4-7-16(23)21(26)17(24)10-9-13-5-2-3-8-19(13)29-22(27)20(14)18(25)12-15/h4,6,9-13,16,19,21,23,25-26H,2-3,5,7-8H2,1H3/b6-4+,10-9-/t13?,16-,19?,21-/m0/s1 |
| InChIKey | KLTBHHQINKJVMC-QHKXXVGUSA-N |
| XLogP | 2.38 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |