C29H36O10 — CID 59466792
[(2E,5S,9S,11Z,13R,14S)-22-(hydroxymethyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-10-yl] acetate (PubChem CID 59466792) has the molecular formula C29H36O10 and a molecular weight of 544.60 g/mol. Its IUPAC name is [(2E,5S,9S,11Z,13R,14S)-22-(hydroxymethyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-10-yl] acetate.
| Compound Name | [(2E,5S,9S,11Z,13R,14S)-22-(hydroxymethyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-10-yl] acetate |
|---|---|
| PubChem CID | 59466792 |
| Molecular Formula | C29H36O10 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(2E,5S,9S,11Z,13R,14S)-22-(hydroxymethyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-10-yl] acetate |
| SMILES | COCOc1cc2oc(CO)cc2c2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(OC(C)=O)[C@H]1OC(C)(C)O[C@H]1C/C=C/2 |
| InChI | InChI=1S/C29H36O10/c1-16-10-11-22(36-18(3)31)27-23(38-29(4,5)39-27)9-7-8-20-21-12-19(14-30)37-24(21)13-25(34-15-33-6)26(20)28(32)35-17(16)2/h7-8,10-13,16-17,22-23,27,30H,9,14-15H2,1-6H3/b8-7+,11-10-/t16-,17+,22?,23+,27-/m1/s1 |
| InChIKey | AJBOEMARIJIXLT-LFADXFBRSA-N |
| XLogP | 4.51 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|