C15H26O5 — CID 59466844
2-[(4S,5S)-5-[(Z)-1-methoxy-5-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid (PubChem CID 59466844) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[(4S,5S)-5-[(Z)-1-methoxy-5-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[(4S,5S)-5-[(Z)-1-methoxy-5-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 59466844 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-[(4S,5S)-5-[(Z)-1-methoxy-5-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid |
| SMILES | COC(/C=C\CC(C)C)[C@H]1OC(C)(C)O[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H26O5/c1-10(2)7-6-8-11(18-5)14-12(9-13(16)17)19-15(3,4)20-14/h6,8,10-12,14H,7,9H2,1-5H3,(H,16,17)/b8-6-/t11?,12-,14+/m0/s1 |
| InChIKey | NUMXBMQXHCKEKE-PWVSBMSHSA-N |
| XLogP | 2.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|