C24H33NO9S — CID 59466848
N-[4-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]butyl]methanesulfonamide (PubChem CID 59466848) has the molecular formula C24H33NO9S and a molecular weight of 511.59 g/mol. Its IUPAC name is N-[4-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]butyl]methanesulfonamide.
| Compound Name | N-[4-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]butyl]methanesulfonamide |
|---|---|
| PubChem CID | 59466848 |
| Molecular Formula | C24H33NO9S |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[4-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]butyl]methanesulfonamide |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(OCCCCNS(C)(=O)=O)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C24H33NO9S/c1-15-9-10-20(27)23(29)19(26)8-6-7-17-13-18(33-12-5-4-11-25-35(3,31)32)14-21(28)22(17)24(30)34-16(15)2/h6-7,9-10,13-16,19,23,25-26,28-29H,4-5,8,11-12H2,1-3H3/b7-6+,10-9-/t15-,16+,19+,23+/m1/s1 |
| InChIKey | CUZQHZUWRCGRFK-VKULIRLMSA-N |
| XLogP | 1.55 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|