C23H31NO9S — CID 59466857
N-[3-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]propyl]methanesulfonamide (PubChem CID 59466857) has the molecular formula C23H31NO9S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[3-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]propyl]methanesulfonamide.
| Compound Name | N-[3-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 59466857 |
| Molecular Formula | C23H31NO9S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[3-[[(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]propyl]methanesulfonamide |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(OCCCNS(C)(=O)=O)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C23H31NO9S/c1-14-8-9-19(26)22(28)18(25)7-4-6-16-12-17(32-11-5-10-24-34(3,30)31)13-20(27)21(16)23(29)33-15(14)2/h4,6,8-9,12-15,18,22,24-25,27-28H,5,7,10-11H2,1-3H3/b6-4+,9-8-/t14-,15+,18+,22+/m1/s1 |
| InChIKey | HSOXNDQAMWIWSV-NDWAJIIBSA-N |
| XLogP | 1.16 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|