C26H37NO8 — CID 59466923
(2E,5S,9R,11Z,13R,14S)-21-(2-aminoethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one (PubChem CID 59466923) has the molecular formula C26H37NO8 and a molecular weight of 491.58 g/mol. Its IUPAC name is (2E,5S,9R,11Z,13R,14S)-21-(2-aminoethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one.
| Compound Name | (2E,5S,9R,11Z,13R,14S)-21-(2-aminoethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one |
|---|---|
| PubChem CID | 59466923 |
| Molecular Formula | C26H37NO8 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2E,5S,9R,11Z,13R,14S)-21-(2-aminoethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one |
| SMILES | COCOc1ccc(OCCN)c2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(O)[C@H]1OC(C)(C)O[C@H]1C/C=C/2 |
| InChI | InChI=1S/C26H37NO8/c1-16-9-10-19(28)24-22(34-26(3,4)35-24)8-6-7-18-20(31-14-13-27)11-12-21(32-15-30-5)23(18)25(29)33-17(16)2/h6-7,9-12,16-17,19,22,24,28H,8,13-15,27H2,1-5H3/b7-6+,10-9-/t16-,17+,19?,22+,24-/m1/s1 |
| InChIKey | KOOXCMHAQYFPAZ-VWLTYPKASA-N |
| XLogP | 3.04 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|