C32H38F2O10 — CID 59466936
2-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-(difluoromethoxy)-6-(methoxymethoxy)benzoic acid (PubChem CID 59466936) has the molecular formula C32H38F2O10 and a molecular weight of 620.64 g/mol. Its IUPAC name is 2-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-(difluoromethoxy)-6-(methoxymethoxy)benzoic acid.
| Compound Name | 2-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-(difluoromethoxy)-6-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 59466936 |
| Molecular Formula | C32H38F2O10 |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 2-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-(difluoromethoxy)-6-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1cc(OC(F)F)cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(/C=C\[C@@H](C)[C@H](C)O)OC(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C32H38F2O10/c1-19(20(2)35)14-15-24(42-30(38)21-10-7-6-8-11-21)28-25(43-32(3,4)44-28)13-9-12-22-16-23(41-31(33)34)17-26(40-18-39-5)27(22)29(36)37/h6-12,14-17,19-20,24-25,28,31,35H,13,18H2,1-5H3,(H,36,37)/b12-9+,15-14-/t19-,20+,24?,25+,28-/m1/s1 |
| InChIKey | VGMDUQJDUJIMET-PYADVYGFSA-N |
| XLogP | 5.69 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|