C23H29NO8 — CID 59466987
N-[2-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide (PubChem CID 59466987) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is N-[2-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide.
| Compound Name | N-[2-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 59466987 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[2-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C23H29NO8/c1-13-7-8-19(27)22(29)18(26)6-4-5-16-11-17(31-10-9-24-15(3)25)12-20(28)21(16)23(30)32-14(13)2/h4-5,7-8,11-14,18,22,26,28-29H,6,9-10H2,1-3H3,(H,24,25)/b5-4+,8-7-/t13-,14-,18-,22-/m0/s1 |
| InChIKey | MCZYDRMJGGIENC-SYEMALLDSA-N |
| XLogP | 1.35 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|