C24H31NO9 — CID 59467020
[3-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaen-15-yl]oxy]propylamino] acetate (PubChem CID 59467020) has the molecular formula C24H31NO9 and a molecular weight of 477.51 g/mol. Its IUPAC name is [3-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaen-15-yl]oxy]propylamino] acetate.
| Compound Name | [3-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaen-15-yl]oxy]propylamino] acetate |
|---|---|
| PubChem CID | 59467020 |
| Molecular Formula | C24H31NO9 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [3-[[(4S,5S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaen-15-yl]oxy]propylamino] acetate |
| SMILES | CC(=O)ONCCCOc1ccc(O)c2c1/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C24H31NO9/c1-14-8-9-20(29)23(30)19(28)7-4-6-17-21(32-13-5-12-25-34-16(3)26)11-10-18(27)22(17)24(31)33-15(14)2/h4,6,8-11,14-15,19,23,25,27-28,30H,5,7,12-13H2,1-3H3/b6-4+,9-8-/t14-,15-,19-,23-/m0/s1 |
| InChIKey | USGIXUQOIPSUMY-LRLAZGFLSA-N |
| XLogP | 1.67 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|