C21H26ClNO6 — CID 59467176
(4S,5R,6Z,9S,10S,12E)-17-chloro-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione (PubChem CID 59467176) has the molecular formula C21H26ClNO6 and a molecular weight of 423.89 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-17-chloro-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-17-chloro-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione |
|---|---|
| PubChem CID | 59467176 |
| Molecular Formula | C21H26ClNO6 |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-17-chloro-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(N(C)C)c(Cl)c(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C21H26ClNO6/c1-11-8-9-16(25)19(26)15(24)7-5-6-13-10-14(23(3)4)18(22)20(27)17(13)21(28)29-12(11)2/h5-6,8-12,15,19,24,26-27H,7H2,1-4H3/b6-5+,9-8-/t11-,12+,15+,19+/m1/s1 |
| InChIKey | PMVZFFOUFNPTMA-IXCNXCPVSA-N |
| XLogP | 2.56 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |