C28H45FO6Si — CID 59467204
2-[(4S,5S)-5-[(E,1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-1-[(4-methoxyphenyl)methoxy]-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 59467204) has the molecular formula C28H45FO6Si and a molecular weight of 524.75 g/mol. Its IUPAC name is 2-[(4S,5S)-5-[(E,1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-1-[(4-methoxyphenyl)methoxy]-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5S)-5-[(E,1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-1-[(4-methoxyphenyl)methoxy]-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 59467204 |
| Molecular Formula | C28H45FO6Si |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 2-[(4S,5S)-5-[(E,1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-1-[(4-methoxyphenyl)methoxy]-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | COc1ccc(CO[C@H](/C(F)=C\[C@@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C28H45FO6Si/c1-19(20(2)35-36(9,10)27(3,4)5)17-23(29)25(26-24(15-16-30)33-28(6,7)34-26)32-18-21-11-13-22(31-8)14-12-21/h11-14,16-17,19-20,24-26H,15,18H2,1-10H3/b23-17+/t19-,20-,24+,25-,26+/m1/s1 |
| InChIKey | HKVCUKIUDDOVLV-FWHCSVCMSA-N |
| XLogP | 6.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|