C18H22O2S2 — CID 59467555
2,3-dimethyl-1,4-bis(phenylsulfanyl)butane-2,3-diol (PubChem CID 59467555) has the molecular formula C18H22O2S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-bis(phenylsulfanyl)butane-2,3-diol.
| Compound Name | 2,3-dimethyl-1,4-bis(phenylsulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 59467555 |
| Molecular Formula | C18H22O2S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2,3-dimethyl-1,4-bis(phenylsulfanyl)butane-2,3-diol |
| SMILES | CC(O)(CSc1ccccc1)C(C)(O)CSc1ccccc1 |
| InChI | InChI=1S/C18H22O2S2/c1-17(19,13-21-15-9-5-3-6-10-15)18(2,20)14-22-16-11-7-4-8-12-16/h3-12,19-20H,13-14H2,1-2H3 |
| InChIKey | AGQZCVHOBLAFHZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |