C15H16F4O — CID 59467752
2-methyl-5-(3,3,4,5-tetrafluoro-1,2-dihydroinden-2-yl)oxane (PubChem CID 59467752) has the molecular formula C15H16F4O and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-methyl-5-(3,3,4,5-tetrafluoro-1,2-dihydroinden-2-yl)oxane.
| Compound Name | 2-methyl-5-(3,3,4,5-tetrafluoro-1,2-dihydroinden-2-yl)oxane |
|---|---|
| PubChem CID | 59467752 |
| Molecular Formula | C15H16F4O |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-methyl-5-(3,3,4,5-tetrafluoro-1,2-dihydroinden-2-yl)oxane |
| SMILES | CC1CCC(C2Cc3ccc(F)c(F)c3C2(F)F)CO1 |
| InChI | InChI=1S/C15H16F4O/c1-8-2-3-10(7-20-8)11-6-9-4-5-12(16)14(17)13(9)15(11,18)19/h4-5,8,10-11H,2-3,6-7H2,1H3 |
| InChIKey | BMCJRUXRQBFCLS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |