About (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol
(2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol (PubChem CID 59467852) has the molecular formula C15H17ClFN3O2
and a molecular weight of 325.77 g/mol. Its IUPAC name is (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol.
Molecular Properties
| Compound Name | (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol |
| PubChem CID | 59467852 |
| Molecular Formula | C15H17ClFN3O2 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol |
| SMILES | CCc1cc(NC[C@@H](O)CO)nc(-c2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H17ClFN3O2/c1-2-10-6-14(18-7-11(22)8-21)20-15(19-10)9-3-4-13(17)12(16)5-9/h3-6,11,21-22H,2,7-8H2,1H3,(H,18,19,20)/t11-/m1/s1 |
| InChIKey | OHRFTSYTQNTOOM-LLVKDONJSA-N |
| XLogP | 2.26 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol?
The IUPAC name of (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol (CID 59467852) is (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol.
What is the SMILES notation for (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol?
The canonical SMILES for (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol is CCc1cc(NC[C@@H](O)CO)nc(-c2ccc(F)c(Cl)c2)n1.
What is the InChIKey of (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol?
The InChIKey is OHRFTSYTQNTOOM-LLVKDONJSA-N. The full InChI is InChI=1S/C15H17ClFN3O2/c1-2-10-6-14(18-7-11(22)8-21)20-15(19-10)9-3-4-13(17)12(16)5-9/h3-6,11,21-22H,2,7-8H2,1H3,(H,18,19,20)/t11-/m1/s1.
What are the key properties of (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol?
(2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol has a molecular weight of 325.77 g/mol, XLogP of 2.26, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-[[2-(3-chloro-4-fluorophenyl)-6-ethylpyrimidin-4-yl]amino]propane-1,2-diol is sourced from PubChem (CID 59467852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).