About 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one
4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one (PubChem CID 59468068) has the molecular formula C27H28N4O
and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one |
| PubChem CID | 59468068 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(NC2CC(Cc3ccccc3)NC(Cc3ccccc3)C2)c2ccccc12 |
| InChI | InChI=1S/C27H28N4O/c32-27-25-14-8-7-13-24(25)26(30-31-27)29-23-17-21(15-19-9-3-1-4-10-19)28-22(18-23)16-20-11-5-2-6-12-20/h1-14,21-23,28H,15-18H2,(H,29,30)(H,31,32) |
| InChIKey | LXWXJGJTXWGCKT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one?
The IUPAC name of 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one (CID 59468068) is 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one.
What is the SMILES notation for 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one?
The canonical SMILES for 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one is O=c1[nH]nc(NC2CC(Cc3ccccc3)NC(Cc3ccccc3)C2)c2ccccc12.
What is the InChIKey of 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one?
The InChIKey is LXWXJGJTXWGCKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O/c32-27-25-14-8-7-13-24(25)26(30-31-27)29-23-17-21(15-19-9-3-1-4-10-19)28-22(18-23)16-20-11-5-2-6-12-20/h1-14,21-23,28H,15-18H2,(H,29,30)(H,31,32).
What are the key properties of 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one?
4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one has a molecular weight of 424.55 g/mol, XLogP of 4.31, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dibenzylpiperidin-4-yl)amino]-2H-phthalazin-1-one is sourced from PubChem (CID 59468068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).