C24H29N5O2S — CID 59468557
5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 59468557) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59468557 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | CC(O)c1cccc(Nc2nccc(-c3ccc(C(=O)NCCC4CCCN4C)s3)n2)c1 |
| InChI | InChI=1S/C24H29N5O2S/c1-16(30)17-5-3-6-18(15-17)27-24-26-13-11-20(28-24)21-8-9-22(32-21)23(31)25-12-10-19-7-4-14-29(19)2/h3,5-6,8-9,11,13,15-16,19,30H,4,7,10,12,14H2,1-2H3,(H,25,31)(H,26,27,28) |
| InChIKey | SMJGOEOAHYZRHJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |