About 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline
8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline (PubChem CID 59469591) has the molecular formula C11H10N2
and a molecular weight of 170.22 g/mol. Its IUPAC name is 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline.
Molecular Properties
| Compound Name | 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline |
| PubChem CID | 59469591 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline |
| SMILES | c1cc2ccc3c(c2cn1)CCN3 |
| InChI | InChI=1S/C11H10N2/c1-2-11-9(4-6-13-11)10-7-12-5-3-8(1)10/h1-3,5,7,13H,4,6H2 |
| InChIKey | HCHHDCSBBGQWAA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline?
The IUPAC name of 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline (CID 59469591) is 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline.
What is the SMILES notation for 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline?
The canonical SMILES for 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline is c1cc2ccc3c(c2cn1)CCN3.
What is the InChIKey of 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline?
The InChIKey is HCHHDCSBBGQWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-11-9(4-6-13-11)10-7-12-5-3-8(1)10/h1-3,5,7,13H,4,6H2.
What are the key properties of 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline?
8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline has a molecular weight of 170.22 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-7H-pyrrolo[2,3-h]isoquinoline is sourced from PubChem (CID 59469591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).