About 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline
8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline (PubChem CID 59469621) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline.
Molecular Properties
| Compound Name | 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline |
| PubChem CID | 59469621 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline |
| SMILES | c1cnc2c3c(ccc2n1)CCN3 |
| InChI | InChI=1S/C10H9N3/c1-2-8-10(13-6-5-11-8)9-7(1)3-4-12-9/h1-2,5-6,12H,3-4H2 |
| InChIKey | AQIOFSSRHPQMEZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline?
The IUPAC name of 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline (CID 59469621) is 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline.
What is the SMILES notation for 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline?
The canonical SMILES for 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline is c1cnc2c3c(ccc2n1)CCN3.
What is the InChIKey of 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline?
The InChIKey is AQIOFSSRHPQMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-2-8-10(13-6-5-11-8)9-7(1)3-4-12-9/h1-2,5-6,12H,3-4H2.
What are the key properties of 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline?
8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline has a molecular weight of 171.20 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-7H-pyrrolo[2,3-f]quinoxaline is sourced from PubChem (CID 59469621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).