About 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine
2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine (PubChem CID 59469623) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine |
| PubChem CID | 59469623 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine |
| SMILES | c1nncc2cc3c(cc12)CCN3 |
| InChI | InChI=1S/C10H9N3/c1-2-11-10-4-9-6-13-12-5-8(9)3-7(1)10/h3-6,11H,1-2H2 |
| InChIKey | CIJVBHAHXGOKJP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine?
The IUPAC name of 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine (CID 59469623) is 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine.
What is the SMILES notation for 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine?
The canonical SMILES for 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine is c1nncc2cc3c(cc12)CCN3.
What is the InChIKey of 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine?
The InChIKey is CIJVBHAHXGOKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-2-11-10-4-9-6-13-12-5-8(9)3-7(1)10/h3-6,11H,1-2H2.
What are the key properties of 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine?
2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine has a molecular weight of 171.20 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrrolo[3,2-g]phthalazine is sourced from PubChem (CID 59469623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).