C29H32N2O4 — CID 59469715
6-[(3R,4R)-3,4-dimethylcyclohexyl]-13-(4-methylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 59469715) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 6-[(3R,4R)-3,4-dimethylcyclohexyl]-13-(4-methylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-[(3R,4R)-3,4-dimethylcyclohexyl]-13-(4-methylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59469715 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 6-[(3R,4R)-3,4-dimethylcyclohexyl]-13-(4-methylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CC1CCC(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(C2CC[C@@H](C)[C@H](C)C2)C4=O)CC1 |
| InChI | InChI=1S/C29H32N2O4/c1-15-4-7-18(8-5-15)30-26(32)20-10-12-22-25-23(13-11-21(24(20)25)27(30)33)29(35)31(28(22)34)19-9-6-16(2)17(3)14-19/h10-13,15-19H,4-9,14H2,1-3H3/t15?,16-,17-,18?,19?/m1/s1 |
| InChIKey | CNXPYJLVDUNFRG-PXWOONSHSA-N |
| XLogP | 5.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|