C34H24IrN- — CID 59470259
2-[4-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]benzo[f]isoquinoline;iridium (PubChem CID 59470259) has the molecular formula C34H24IrN- and a molecular weight of 638.79 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]benzo[f]isoquinoline;iridium.
| Compound Name | 2-[4-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]benzo[f]isoquinoline;iridium |
|---|---|
| PubChem CID | 59470259 |
| Molecular Formula | C34H24IrN- |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 2-[4-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]benzo[f]isoquinoline;iridium |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c[c-]c(-c4cc5c(ccc6ccccc65)cn4)cc3)cc21.[Ir] |
| InChI | InChI=1S/C34H24N.Ir/c1-34(2)31-10-6-5-9-28(31)29-18-17-25(19-32(29)34)22-11-14-24(15-12-22)33-20-30-26(21-35-33)16-13-23-7-3-4-8-27(23)30;/h3-14,16-21H,1-2H3;/q-1; |
| InChIKey | HHFOYQKZDIHZHZ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|