C46H40N2 — CID 59470459
1-N,4-N-bis(3,4-dimethylphenyl)-1-N,4-N-bis(4-phenylphenyl)benzene-1,4-diamine (PubChem CID 59470459) has the molecular formula C46H40N2 and a molecular weight of 620.84 g/mol. Its IUPAC name is 1-N,4-N-bis(3,4-dimethylphenyl)-1-N,4-N-bis(4-phenylphenyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(3,4-dimethylphenyl)-1-N,4-N-bis(4-phenylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 59470459 |
| Molecular Formula | C46H40N2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 1-N,4-N-bis(3,4-dimethylphenyl)-1-N,4-N-bis(4-phenylphenyl)benzene-1,4-diamine |
| SMILES | Cc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(C)c(C)c3)cc2)cc1C |
| InChI | InChI=1S/C46H40N2/c1-33-15-21-45(31-35(33)3)47(41-23-17-39(18-24-41)37-11-7-5-8-12-37)43-27-29-44(30-28-43)48(46-22-16-34(2)36(4)32-46)42-25-19-40(20-26-42)38-13-9-6-10-14-38/h5-32H,1-4H3 |
| InChIKey | RWSGPUOGWIMRME-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |