About (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one
(4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one (PubChem CID 59470861) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one.
Molecular Properties
| Compound Name | (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one |
| PubChem CID | 59470861 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one |
| SMILES | CC(C)C(=O)[C@@H](Nc1ccncn1)C(C)C |
| InChI | InChI=1S/C12H19N3O/c1-8(2)11(12(16)9(3)4)15-10-5-6-13-7-14-10/h5-9,11H,1-4H3,(H,13,14,15)/t11-/m0/s1 |
| InChIKey | RPPZUWHZTFMUNG-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one?
The IUPAC name of (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one (CID 59470861) is (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one.
What is the SMILES notation for (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one?
The canonical SMILES for (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one is CC(C)C(=O)[C@@H](Nc1ccncn1)C(C)C.
What is the InChIKey of (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one?
The InChIKey is RPPZUWHZTFMUNG-NSHDSACASA-N. The full InChI is InChI=1S/C12H19N3O/c1-8(2)11(12(16)9(3)4)15-10-5-6-13-7-14-10/h5-9,11H,1-4H3,(H,13,14,15)/t11-/m0/s1.
What are the key properties of (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one?
(4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one has a molecular weight of 221.30 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,5-dimethyl-4-(pyrimidin-4-ylamino)hexan-3-one is sourced from PubChem (CID 59470861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).