C27H42N+ — CID 59471134
5-[(4E)-7-(2,3-dimethyl-4-propan-2-ylcyclopenta-1,3-dien-1-yl)-3,4,5,6-tetramethylocta-2,4,6-trien-2-yl]-1-methyl-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 59471134) has the molecular formula C27H42N+ and a molecular weight of 380.64 g/mol. Its IUPAC name is 5-[(4E)-7-(2,3-dimethyl-4-propan-2-ylcyclopenta-1,3-dien-1-yl)-3,4,5,6-tetramethylocta-2,4,6-trien-2-yl]-1-methyl-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | 5-[(4E)-7-(2,3-dimethyl-4-propan-2-ylcyclopenta-1,3-dien-1-yl)-3,4,5,6-tetramethylocta-2,4,6-trien-2-yl]-1-methyl-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 59471134 |
| Molecular Formula | C27H42N+ |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 5-[(4E)-7-(2,3-dimethyl-4-propan-2-ylcyclopenta-1,3-dien-1-yl)-3,4,5,6-tetramethylocta-2,4,6-trien-2-yl]-1-methyl-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | CC1=C(C(C)=C(C)/C(C)=C(\C)C(C)=C(C)C2=[N+](C)CCC2)CC(C(C)C)=C1C |
| InChI | InChI=1S/C27H42N/c1-16(2)25-15-26(23(9)22(25)8)21(7)19(5)17(3)18(4)20(6)24(10)27-13-12-14-28(27)11/h16H,12-15H2,1-11H3/q+1/b18-17+,21-19?,24-20? |
| InChIKey | WRPWYFQYQDIHDX-DWFJASETSA-N |
| XLogP | 7.57 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|