About 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate
4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate (PubChem CID 59471202) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate.
Molecular Properties
| Compound Name | 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate |
| PubChem CID | 59471202 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate |
| SMILES | CC(=O)OC1C=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C13H16O2/c1-8(14)15-11-4-5-12-9-2-3-10(6-9)13(12)7-11/h2-5,9-13H,6-7H2,1H3 |
| InChIKey | WQMRRASHQOMZLW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate?
The IUPAC name of 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate (CID 59471202) is 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate.
What is the SMILES notation for 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate?
The canonical SMILES for 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate is CC(=O)OC1C=CC2C3C=CC(C3)C2C1.
What is the InChIKey of 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate?
The InChIKey is WQMRRASHQOMZLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-8(14)15-11-4-5-12-9-2-3-10(6-9)13(12)7-11/h2-5,9-13H,6-7H2,1H3.
What are the key properties of 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate?
4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate has a molecular weight of 204.27 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tricyclo[6.2.1.02,7]undeca-5,9-dienyl acetate is sourced from PubChem (CID 59471202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).