C21H19ClFN3O5S — CID 59471439
methyl 2-[3-chloro-7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-10-yl]-2-oxoacetate (PubChem CID 59471439) has the molecular formula C21H19ClFN3O5S and a molecular weight of 479.92 g/mol. Its IUPAC name is methyl 2-[3-chloro-7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-10-yl]-2-oxoacetate.
| Compound Name | methyl 2-[3-chloro-7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-10-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 59471439 |
| Molecular Formula | C21H19ClFN3O5S |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | methyl 2-[3-chloro-7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-10-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c2n(c3cc(Cl)ncc13)CC(N(C)S(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H19ClFN3O5S/c1-25(32(29,30)14-6-3-12(23)4-7-14)13-5-8-16-19(20(27)21(28)31-2)15-10-24-18(22)9-17(15)26(16)11-13/h3-4,6-7,9-10,13H,5,8,11H2,1-2H3 |
| InChIKey | HZYQFZUTXOLNTD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|