C22H23N7O2 — CID 59471697
5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-amine (PubChem CID 59471697) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-amine.
| Compound Name | 5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 59471697 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-amine |
| SMILES | CN(C)CCCOc1ccc(-c2cnc(N)c(-c3nnc(-c4ccccc4)o3)n2)cn1 |
| InChI | InChI=1S/C22H23N7O2/c1-29(2)11-6-12-30-18-10-9-16(13-24-18)17-14-25-20(23)19(26-17)22-28-27-21(31-22)15-7-4-3-5-8-15/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H2,23,25) |
| InChIKey | YYEDCKLGNZKLSB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|