C30H37N7O2 — CID 59471807
benzenecarboximidoyl 3-amino-6-[4-[4-(3,3-dimethylbutyl)-1,4-diazepane-1-carbonyl]phenyl]pyrazine-2-carboximidate (PubChem CID 59471807) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is benzenecarboximidoyl 3-amino-6-[4-[4-(3,3-dimethylbutyl)-1,4-diazepane-1-carbonyl]phenyl]pyrazine-2-carboximidate.
| Compound Name | benzenecarboximidoyl 3-amino-6-[4-[4-(3,3-dimethylbutyl)-1,4-diazepane-1-carbonyl]phenyl]pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 59471807 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | benzenecarboximidoyl 3-amino-6-[4-[4-(3,3-dimethylbutyl)-1,4-diazepane-1-carbonyl]phenyl]pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1nc(-c2ccc(C(=O)N3CCCN(CCC(C)(C)C)CC3)cc2)cnc1N |
| InChI | InChI=1S/C30H37N7O2/c1-30(2,3)14-17-36-15-7-16-37(19-18-36)29(38)23-12-10-21(11-13-23)24-20-34-26(31)25(35-24)28(33)39-27(32)22-8-5-4-6-9-22/h4-6,8-13,20,32-33H,7,14-19H2,1-3H3,(H2,31,34)/b32-27+,33-28- |
| InChIKey | RJZKHMPLCHNOFO-QPNRKFHMSA-N |
| XLogP | 4.68 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|