C25H26N6O3S — CID 59471837
tert-butyl N-[2-[2-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]phenyl]sulfanylethyl]carbamate (PubChem CID 59471837) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]phenyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]phenyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 59471837 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | tert-butyl N-[2-[2-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]phenyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSc1ccccc1-c1cnc(N)c(-c2nnc(-c3ccccc3)o2)n1 |
| InChI | InChI=1S/C25H26N6O3S/c1-25(2,3)34-24(32)27-13-14-35-19-12-8-7-11-17(19)18-15-28-21(26)20(29-18)23-31-30-22(33-23)16-9-5-4-6-10-16/h4-12,15H,13-14H2,1-3H3,(H2,26,28)(H,27,32) |
| InChIKey | SSYZBDIIQJLDSV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|