C25H27FN6O3S — CID 59471852
[2-fluoro-4-[(oxetan-3-ylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfinylphenyl)pyrazine-2-carboximidate (PubChem CID 59471852) has the molecular formula C25H27FN6O3S and a molecular weight of 510.60 g/mol. Its IUPAC name is [2-fluoro-4-[(oxetan-3-ylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfinylphenyl)pyrazine-2-carboximidate.
| Compound Name | [2-fluoro-4-[(oxetan-3-ylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfinylphenyl)pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 59471852 |
| Molecular Formula | C25H27FN6O3S |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [2-fluoro-4-[(oxetan-3-ylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfinylphenyl)pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(CNC2COC2)cc1F)c1nc(-c2ccc(S(=O)C(C)C)cc2)cnc1N |
| InChI | InChI=1S/C25H27FN6O3S/c1-14(2)36(33)18-6-4-16(5-7-18)21-11-31-23(27)22(32-21)25(29)35-24(28)19-8-3-15(9-20(19)26)10-30-17-12-34-13-17/h3-9,11,14,17,28-30H,10,12-13H2,1-2H3,(H2,27,31)/b28-24+,29-25- |
| InChIKey | PGHQYLWQVDGPQS-CIMIHRMLSA-N |
| XLogP | 3.24 |
| TPSA | 147.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|