C18H16N4O2 — CID 59471893
3-amino-6-[4-(hydroxymethyl)phenyl]-N-phenylpyrazine-2-carboxamide (PubChem CID 59471893) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-amino-6-[4-(hydroxymethyl)phenyl]-N-phenylpyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[4-(hydroxymethyl)phenyl]-N-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59471893 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-amino-6-[4-(hydroxymethyl)phenyl]-N-phenylpyrazine-2-carboxamide |
| SMILES | Nc1ncc(-c2ccc(CO)cc2)nc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H16N4O2/c19-17-16(18(24)21-14-4-2-1-3-5-14)22-15(10-20-17)13-8-6-12(11-23)7-9-13/h1-10,23H,11H2,(H2,19,20)(H,21,24) |
| InChIKey | IWECCJAPMHJIGI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |