About 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 59472048) has the molecular formula C21H14N6O
and a molecular weight of 366.38 g/mol. Its IUPAC name is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine |
| PubChem CID | 59472048 |
| Molecular Formula | C21H14N6O |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | Nc1ncc(-c2ccc3ncccc3c2)nc1-c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H14N6O/c22-19-18(21-27-26-20(28-21)13-5-2-1-3-6-13)25-17(12-24-19)15-8-9-16-14(11-15)7-4-10-23-16/h1-12H,(H2,22,24) |
| InChIKey | BDWAVOQBWGTBMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine?
The IUPAC name of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine (CID 59472048) is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine.
What is the SMILES notation for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine?
The canonical SMILES for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine is Nc1ncc(-c2ccc3ncccc3c2)nc1-c1nnc(-c2ccccc2)o1.
What is the InChIKey of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine?
The InChIKey is BDWAVOQBWGTBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N6O/c22-19-18(21-27-26-20(28-21)13-5-2-1-3-6-13)25-17(12-24-19)15-8-9-16-14(11-15)7-4-10-23-16/h1-12H,(H2,22,24).
What are the key properties of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine?
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine has a molecular weight of 366.38 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-quinolin-6-ylpyrazin-2-amine is sourced from PubChem (CID 59472048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).