About 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine (PubChem CID 59472250) has the molecular formula C21H20N8O
and a molecular weight of 400.45 g/mol. Its IUPAC name is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine |
| PubChem CID | 59472250 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine |
| SMILES | Nc1ncc(-c2ccnc(N3CCNCC3)c2)nc1-c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H20N8O/c22-19-18(21-28-27-20(30-21)14-4-2-1-3-5-14)26-16(13-25-19)15-6-7-24-17(12-15)29-10-8-23-9-11-29/h1-7,12-13,23H,8-11H2,(H2,22,25) |
| InChIKey | DNWOZPQMWWCZAE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine?
The IUPAC name of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine (CID 59472250) is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine.
What is the SMILES notation for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine?
The canonical SMILES for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine is Nc1ncc(-c2ccnc(N3CCNCC3)c2)nc1-c1nnc(-c2ccccc2)o1.
What is the InChIKey of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine?
The InChIKey is DNWOZPQMWWCZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N8O/c22-19-18(21-28-27-20(30-21)14-4-2-1-3-5-14)26-16(13-25-19)15-6-7-24-17(12-15)29-10-8-23-9-11-29/h1-7,12-13,23H,8-11H2,(H2,22,25).
What are the key properties of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine?
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine has a molecular weight of 400.45 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-5-(2-piperazin-1-yl-4-pyridinyl)pyrazin-2-amine is sourced from PubChem (CID 59472250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).