C24H21ClF3N7O2 — CID 59472676
7-chloro-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 59472676) has the molecular formula C24H21ClF3N7O2 and a molecular weight of 531.93 g/mol. Its IUPAC name is 7-chloro-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 7-chloro-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 59472676 |
| Molecular Formula | C24H21ClF3N7O2 |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 7-chloro-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | COc1cc(-c2cn(C3CCc4cc(Cl)ccc4N(CC(F)(F)F)C3=O)nn2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C24H21ClF3N7O2/c1-14-29-13-35(31-14)20-6-3-15(10-22(20)37-2)18-11-34(32-30-18)21-7-4-16-9-17(25)5-8-19(16)33(23(21)36)12-24(26,27)28/h3,5-6,8-11,13,21H,4,7,12H2,1-2H3 |
| InChIKey | AEIXBXAIIXDEPX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |