C25H25N7O — CID 59473079
N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 59473079) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 59473079 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C[C@@H]1CN(c2ccc(Nc3nc(-c4ccc5cn[nH]c5c4)cn4ccnc34)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H25N7O/c1-16-13-32(14-17(2)33-16)21-7-5-20(6-8-21)28-24-25-26-9-10-31(25)15-23(29-24)18-3-4-19-12-27-30-22(19)11-18/h3-12,15-17H,13-14H2,1-2H3,(H,27,30)(H,28,29)/t16-,17+ |
| InChIKey | BYAVZVVEXOQOAV-CALCHBBNSA-N |
| XLogP | 4.63 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|