C25H26N6O — CID 59473083
N-(4-morpholin-4-ylphenyl)-6-(1,2,3,4-tetrahydroisoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 59473083) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-6-(1,2,3,4-tetrahydroisoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-6-(1,2,3,4-tetrahydroisoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 59473083 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-6-(1,2,3,4-tetrahydroisoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | c1cn2cc(-c3ccc4c(c3)CCNC4)nc(Nc3ccc(N4CCOCC4)cc3)c2n1 |
| InChI | InChI=1S/C25H26N6O/c1-2-20-16-26-8-7-18(20)15-19(1)23-17-31-10-9-27-25(31)24(29-23)28-21-3-5-22(6-4-21)30-11-13-32-14-12-30/h1-6,9-10,15,17,26H,7-8,11-14,16H2,(H,28,29) |
| InChIKey | UHWQRTSNPYLWKV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|